Octanoyl-DL-carnitine (chloride) structure
|
Common Name | Octanoyl-DL-carnitine (chloride) | ||
|---|---|---|---|---|
| CAS Number | 14919-35-8 | Molecular Weight | 323.86 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H30ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Octanoyl-DL-carnitine (chloride)Octanoylcarnitine chloride is a homolog of acetylcarnitine chloride. Octanoylcarnitine chloride can enhance absorption of drugs from gastrointestinal tract[1]. |
| Name | rac Octanoyl Carnitine Chloride |
|---|---|
| Synonym | More Synonyms |
| Description | Octanoylcarnitine chloride is a homolog of acetylcarnitine chloride. Octanoylcarnitine chloride can enhance absorption of drugs from gastrointestinal tract[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H30ClNO4 |
|---|---|
| Molecular Weight | 323.86 |
| Exact Mass | 323.186340 |
| PSA | 63.60000 |
| InChIKey | MYMFUYYXIJGKKU-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)OC(CC(=O)O)C[N+](C)(C)C.[Cl-] |
| WGK Germany | 3 |
|---|---|
| HS Code | 2923900090 |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-Carboxy-N,N,N-trimethyl-2-(octanoyloxy)propan-1-aminium chloride |
| octanoylcarnitine chloride |
| octanoylcarnitite hydrochloride |
| O-Octoylcarnitinhydrochlorid |
| 1-Propanaminium, 3-carboxy-N,N,N-trimethyl-2-[(1-oxooctyl)oxy]-, chloride (1:1) |
| DL-octanoylcarnitine chloride |
| OCTANOYL-DL-CARNITIN CHLORIDE |
| 3-Carboxy-N,N,N-trimethyl-2-(octanoyloxy)-1-propanaminium chloride |