4-[(4-ethoxyphenyl)methylideneamino]benzoic acid structure
|
Common Name | 4-[(4-ethoxyphenyl)methylideneamino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 14921-71-2 | Molecular Weight | 269.29500 | |
| Density | 1.13g/cm3 | Boiling Point | 464.2ºC at 760mmHg | |
| Molecular Formula | C16H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.5ºC | |
| Name | 4-[(4-ethoxyphenyl)methylideneamino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 464.2ºC at 760mmHg |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.29500 |
| Flash Point | 234.5ºC |
| Exact Mass | 269.10500 |
| PSA | 58.89000 |
| LogP | 3.53410 |
| Vapour Pressure | 2.05E-09mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | DRQCKLPNMDBVQL-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C=Nc2ccc(C(=O)O)cc2)cc1 |
|
~51%
4-[(4-ethoxyphe... CAS#:14921-71-2 |
| Literature: Walsh; Meegan; Prendergast; Al Nakib European Journal of Medicinal Chemistry, 1996 , vol. 31, # 12 p. 989 - 1000 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-Ethoxybenzyliden-p-aminobenzoesaeure |