4-(4-Carboxy-phenyl)-piperidine-1-carboxylic acid tert-butyl ester structure
|
Common Name | 4-(4-Carboxy-phenyl)-piperidine-1-carboxylic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 149353-75-3 | Molecular Weight | 305.369 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 448.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.7±28.7 °C | |
| Name | 4-(1-(tert-Butoxycarbonyl)piperidin-4-yl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 448.0±45.0 °C at 760 mmHg |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.369 |
| Flash Point | 224.7±28.7 °C |
| Exact Mass | 305.162720 |
| PSA | 66.84000 |
| LogP | 3.28 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.546 |
| InChIKey | YCNVQGGUCDVTIZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc(C(=O)O)cc2)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]benzoic acid |
| 4-[1-(tert-Butoxycarbonyl)piperidin-4-yl]benzoic acid |
| 1-Piperidinecarboxylic acid, 4-(4-carboxyphenyl)-, 1-(1,1-dimethylethyl) ester |
| 4-(1-{[(2-Methyl-2-propanyl)oxy]carbonyl}-4-piperidinyl)benzoic acid |
| 4-(4-Carboxy-phenyl)-piperidine-1-carboxylic acid tert-butyl ester |