N-(3-Ethyl-2-pyridinyl)carbamic acid tert-butyl ester structure
|
Common Name | N-(3-Ethyl-2-pyridinyl)carbamic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 149489-03-2 | Molecular Weight | 222.283 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 289.7±28.0 °C at 760 mmHg | |
| Molecular Formula | C12H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.0±24.0 °C | |
| Name | tert-butyl N-(3-ethylpyridin-2-yl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 289.7±28.0 °C at 760 mmHg |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.283 |
| Flash Point | 129.0±24.0 °C |
| Exact Mass | 222.136826 |
| PSA | 51.22000 |
| LogP | 2.64 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | IQRKFAYMMZQJCK-UHFFFAOYSA-N |
| SMILES | CCc1cccnc1NC(=O)OC(C)(C)C |
| HS Code | 2933399090 |
|---|
|
~76%
N-(3-Ethyl-2-py... CAS#:149489-03-2 |
| Literature: TAIHO PHARMACEUTICAL CO., LTD. Patent: US2012/108589 A1, 2012 ; Location in patent: Page/Page column 28 ; |
|
~42%
N-(3-Ethyl-2-py... CAS#:149489-03-2 |
| Literature: Medivir AB Patent: US5593993 A1, 1997 ; |
|
~%
N-(3-Ethyl-2-py... CAS#:149489-03-2 |
| Literature: Synthesis, , # 7 p. 877 - 882 |
|
~%
N-(3-Ethyl-2-py... CAS#:149489-03-2 |
| Literature: Synthesis, , # 7 p. 877 - 882 |
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Carbamic acid,(3-ethyl-2-pyridinyl)-,1,1-dimethylethyl ester (9Cl) |
| 2-t-Butoxycarbonylamino-3-ethylpyridine |
| 2-tert-butoxycarbonylamino-3-ethylpyridine |
| N-(3-ETHYL-2-PYRIDINYL)CARBAMIC ACID TERT-BUTYL ESTER |
| tert-Butyl (3-ethylpyridin-2-yl)carbamate |
| 2-Methyl-2-propanyl (3-ethyl-2-pyridinyl)carbamate |
| Carbamic acid, N-(3-ethyl-2-pyridinyl)-, 1,1-dimethylethyl ester |