1-(4-Ethylphenyl)-4,4,4-trifluoro-1,3-butanedione structure
|
Common Name | 1-(4-Ethylphenyl)-4,4,4-trifluoro-1,3-butanedione | ||
|---|---|---|---|---|
| CAS Number | 1495-03-0 | Molecular Weight | 244.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-ethylphenyl)-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11F3O2 |
|---|---|
| Molecular Weight | 244.21000 |
| Exact Mass | 244.07100 |
| PSA | 34.14000 |
| LogP | 2.95320 |
| InChIKey | KDDQMNMAUZHOMD-UHFFFAOYSA-N |
| SMILES | CCc1ccc(C(=O)CC(=O)C(F)(F)F)cc1 |
| HS Code | 2914700090 |
|---|
|
~64%
1-(4-Ethylpheny... CAS#:1495-03-0 |
| Literature: J.B. Chemicals and Pharmaceuticals Limited Patent: US2001/47023 A1, 2001 ; |
|
~%
1-(4-Ethylpheny... CAS#:1495-03-0 |
| Literature: Singh, Sunil K.; Reddy, P. Ganapati; Rao, K. Srinivasa; Lohray, Braj B.; Misra; Rajjak, Shaikh A.; Rao, Yeleswarapu K.; Venkateswarlu Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 2 p. 499 - 504 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(4-ethylphenyl)-4,4,4-trifluorobutane-1,3-dione |
| 1-(4-Ethylphenyl)-4,4,4-trifluoro-1,3-butanedione |
| 1,3-Butanedione, 1-(4-ethylphenyl)-4,4,4-trifluoro- |