1-(4-Biphenylyl)-4,4,4-trifluoro-1,3-butanedione
1-(4-Biphenylyl)-4,4,4-trifluoro-1,3-butanedione structure
|
Common Name | 1-(4-Biphenylyl)-4,4,4-trifluoro-1,3-butanedione | ||
|---|---|---|---|---|
| CAS Number | 581-83-9 | Molecular Weight | 292.253 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 372.9±37.0 °C at 760 mmHg | |
| Molecular Formula | C16H11F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.3±23.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 372.9±37.0 °C at 760 mmHg |
| Molecular Formula | C16H11F3O2 |
| Molecular Weight | 292.253 |
| Flash Point | 134.3±23.3 °C |
| Exact Mass | 292.071106 |
| PSA | 34.14000 |
| LogP | 6.02 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | ZLQXJKTXGNVKQB-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)C(F)(F)F)c1ccc(-c2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1-(4-Biphenylyl)-4,4,4-trifluoro-1,3-butanedione |
| 1-(4-phenylphenyl)-4,4,4-trifluorobutane-1,3-dione |
| 1-biphenyl-4-yl-4,4,4-trifluoro-butane-1,3-dione |
| 4,4,4-Trifluor-1-{biphenylyl-(4)}-butandion-(1,3) |
| 1-Biphenyl-4-yl-4,4,4-trifluor-butan-1,3-dion |
| 4,4,4-trifluoro-1-(biphenylyl-4)-1,3-butanedione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione? |
| A: The English name of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione is 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione. |
| Q: What is the polar surface area (PSA) of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione? |
| A: Polar surface area (PSA) of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione is 34.14000. |
| Q: What is the boiling point of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione? |
| A: Boiling point of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione is 372.9±37.0 °C at 760 mmHg. |
| Q: What English synonyms does 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione have? |
| A: English synonyms of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione: 1-(4-Biphenylyl)-4,4,4-trifluoro-1,3-butanedione, 1-(4-phenylphenyl)-4,4,4-trifluorobutane-1,3-dione, 1-biphenyl-4-yl-4,4,4-trifluoro-butane-1,3-dione, 4,4,4-Trifluor-1-{biphenylyl-(4)}-butandion-(1,3), 1-Biphenyl-4-yl-4,4,4-trifluor-butan-1,3-dion, 4,4,4-trifluoro-1-(biphenylyl-4)-1,3-butanedione. |
| Q: What is the SMILES notation of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione? |
| A: SMILES notation of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione is O=C(CC(=O)C(F)(F)F)c1ccc(-c2ccccc2)cc1. |
| Q: What is the LogP of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione? |
| A: LogP of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione is 6.02. |
| Q: What is the molecular weight of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione? |
| A: Molecular weight of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione is 292.253. |
| Q: What is the InChIKey of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione? |
| A: InChIKey of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione is ZLQXJKTXGNVKQB-UHFFFAOYSA-N. |
| Q: What is the CAS number of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione? |
| A: CAS number of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione is 581-83-9. |
| Q: What are the upstream materials of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione? |
| A: Related upstream materials(CAS) of 4,4,4-trifluoro-1-(4-phenylphenyl)butane-1,3-dione: 92-91-1;383-63-1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |