Marmin structure
|
Common Name | Marmin | ||
|---|---|---|---|---|
| CAS Number | 14957-38-1 | Molecular Weight | 332.39 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 531.9±50.0 °C at 760 mmHg | |
| Molecular Formula | C19H24O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.8±23.6 °C | |
Use of MarminMarmin is a coumarin, that can be isolated from the immature bark of Aegle marmelos Correa. Marmin antagonizes the Histamine (HY-B1204)-induced contraction in competitive manner[1][2]. |
| Name | 7-[(E,6R)-6,7-dihydroxy-3,7-dimethyloct-2-enoxy]chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Description | Marmin is a coumarin, that can be isolated from the immature bark of Aegle marmelos Correa. Marmin antagonizes the Histamine (HY-B1204)-induced contraction in competitive manner[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 531.9±50.0 °C at 760 mmHg |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.39 |
| Flash Point | 188.8±23.6 °C |
| Exact Mass | 332.162384 |
| PSA | 79.90000 |
| LogP | 2.45 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | QYYKWTUUCOTGNS-JIIJFUIFSA-N |
| SMILES | CC(=CCOc1ccc2ccc(=O)oc2c1)CCC(O)C(C)(C)O |
| Hazard Codes | Xi |
|---|
| HMS2198E18 |
| Marmin |
| 2H-1-Benzopyran-2-one, 7-[[(2E,6R)-6,7-dihydroxy-3,7-dimethyl-2-octen-1-yl]oxy]- |
| 7-{[(2E,6R)-6,7-Dihydroxy-3,7-dimethyl-2-octen-1-yl]oxy}-2H-chromen-2-one |