9H-XANTHEN-9-ONE, 2-(TRIFLUOROMETHYL)- structure
|
Common Name | 9H-XANTHEN-9-ONE, 2-(TRIFLUOROMETHYL)- | ||
|---|---|---|---|---|
| CAS Number | 1496-15-7 | Molecular Weight | 264.19900 | |
| Density | 1.411g/cm3 | Boiling Point | 359ºC at 760 mmHg | |
| Molecular Formula | C14H7F3O2 | Melting Point | 121-122ºC | |
| MSDS | N/A | Flash Point | 165.2ºC | |
| Name | 2-(trifluoromethyl)xanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.411g/cm3 |
|---|---|
| Boiling Point | 359ºC at 760 mmHg |
| Melting Point | 121-122ºC |
| Molecular Formula | C14H7F3O2 |
| Molecular Weight | 264.19900 |
| Flash Point | 165.2ºC |
| Exact Mass | 264.04000 |
| PSA | 30.21000 |
| LogP | 3.96500 |
| Vapour Pressure | 2.45E-05mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | LEOGBDMNMFJKRV-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2oc2ccc(C(F)(F)F)cc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-trifluoromethylxanthone |
| 2-Trifluoromethyl-xanthen-9-one |
| 2-Trifluormethyl-xanthenon |
| 2-(Trifluoromethyl)-9H-xanthen-9-one |