1-Methoxy-2-phenyl-1H-indole-3-carbaldehyde structure
|
Common Name | 1-Methoxy-2-phenyl-1H-indole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 14960-63-5 | Molecular Weight | 251.28000 | |
| Density | 1.15g/cm3 | Boiling Point | 444ºC at 760mmHg | |
| Molecular Formula | C16H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.3ºC | |
| Name | 1-Methoxy-2-phenyl-1H-indole-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Boiling Point | 444ºC at 760mmHg |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.28000 |
| Flash Point | 222.3ºC |
| Exact Mass | 251.09500 |
| PSA | 31.23000 |
| LogP | 3.17920 |
| Vapour Pressure | 4.43E-08mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | BPVFSHVFYDLETP-UHFFFAOYSA-N |
| SMILES | COn1c(-c2ccccc2)c(C=O)c2ccccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| phenylketene methyl trimethylsilyl acetal |
| 3-Formyl-1-methoxy-2-phenyl-indol |
| Silane,ethenyldiethoxyphenyl |
| phenylketene methyl trimethysilyl acetal |
| VINYLPHENYLDIETHOXYSILANE |
| 1-trimethylsiloxy-3-phenyl-1-propene |
| 1-methoxy-2-phenyl-indole-3-carbaldehyde |