Methyl-2-phenyl -3-formylindole structure
|
Common Name | Methyl-2-phenyl -3-formylindole | ||
|---|---|---|---|---|
| CAS Number | 1757-72-8 | Molecular Weight | 235.281 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 447.4±33.0 °C at 760 mmHg | |
| Molecular Formula | C16H13NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.4±25.4 °C | |
| Name | 1-Methyl-2-phenyl-1H-indole-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 447.4±33.0 °C at 760 mmHg |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.281 |
| Flash Point | 224.4±25.4 °C |
| Exact Mass | 235.099716 |
| PSA | 22.00000 |
| LogP | 3.57 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | YJOWMBICANYBLV-UHFFFAOYSA-N |
| SMILES | Cn1c(-c2ccccc2)c(C=O)c2ccccc21 |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-3-carboxaldehyde, 1-methyl-2-phenyl- |
| Indole-3-carboxaldehyde, 1-methyl-2-phenyl- |
| MFCD00186065 |
| EINECS 217-149-4 |
| 1-methyl-2-phenylindole-3-carbaldehyde |
| Methyl-2-phenyl -3-formylindole |
| 1-Methyl-2-phenyl-1H-indole-3-carbaldehyde |
| 1-Methyl-2-Phenylindole-3-Carboxaldehyde |