2,4'-Diaminobenzophenone structure
|
Common Name | 2,4'-Diaminobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 14963-42-9 | Molecular Weight | 212.247 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 464.7±30.0 °C at 760 mmHg | |
| Molecular Formula | C13H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.9±24.6 °C | |
| Name | (2-aminophenyl)-(4-aminophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 464.7±30.0 °C at 760 mmHg |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.247 |
| Flash Point | 234.9±24.6 °C |
| Exact Mass | 212.094955 |
| PSA | 69.11000 |
| LogP | 1.74 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | JEXYPPOFQZMCCI-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)c2ccccc2N)cc1 |
| HS Code | 2922399090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2.4'-Diamino-benzophenon |
| (2-aminophenyl)(4-aminophenyl)methanon |
| 2,4'-diamino-benzophenone |
| 2,4'-Diaminobenzophenone |
| Methanone, (2-aminophenyl)(4-aminophenyl)- |
| (2-Aminophenyl)(4-aminophenyl)methanone |
| 2,3-DIFLUOROBENZAMIDINE HYDROCHLORIDE |