2,4'-Diamino[sulfonylbisbenzene] structure
|
Common Name | 2,4'-Diamino[sulfonylbisbenzene] | ||
|---|---|---|---|---|
| CAS Number | 27147-69-9 | Molecular Weight | 248.30100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(4-aminophenyl)sulfonylaniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H12N2O2S |
|---|---|
| Molecular Weight | 248.30100 |
| Exact Mass | 248.06200 |
| PSA | 94.56000 |
| LogP | 3.92700 |
| InChIKey | BYVOGVXITRNMSF-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)c2ccccc2N)cc1 |
| HS Code | 2921590090 |
|---|
|
~%
2,4'-Diamino[su... CAS#:27147-69-9 |
| Literature: Roblin; Williams; Anderson Journal of the American Chemical Society, 1941 , vol. 63, p. 1930,1931 |
|
~%
2,4'-Diamino[su... CAS#:27147-69-9 |
| Literature: Am.Cyanamid Co. Patent: US2336445 , 1941 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2.4'-Sulfonylbis(benzolamin) |
| 2,4--sulfonyldianiline |
| 2-(4-aminophenylsulfonyl)aniline |
| o,p'-Sulfonyldianiline |
| (2-amino-phenyl)-(4-amino-phenyl)-sulfone |
| Benzenamine,2-[(4-aminophenyl)sulfonyl] |