Suberanilic Acid structure
|
Common Name | Suberanilic Acid | ||
|---|---|---|---|---|
| CAS Number | 149648-52-2 | Molecular Weight | 249.30600 | |
| Density | 1.153 | Boiling Point | 488.556ºC at 760 mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | 123ºC | |
| MSDS | N/A | Flash Point | 249.27℃ | |
| Name | Suberanilic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.153 |
|---|---|
| Boiling Point | 488.556ºC at 760 mmHg |
| Melting Point | 123ºC |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.30600 |
| Flash Point | 249.27℃ |
| Exact Mass | 249.13600 |
| PSA | 66.40000 |
| LogP | 3.12330 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | PAXDAFSGJPGLGR-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCCC(=O)Nc1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 8-anilino-8-oxooctanoic acid |
| 7-Phenylcarbamoylheptanoic acid |