L 731,735
Modify Date: 2025-09-08 20:40:12
L 731,735 structure
|
Common Name | L 731,735 | ||
|---|---|---|---|---|
| CAS Number | 149756-20-7 | Molecular Weight | 420.61000 | |
| Density | 1.113g/cm3 | Boiling Point | 662.6ºC at 760mmHg | |
| Molecular Formula | C19H40N4O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 354.5ºC | |
Use of L 731,735L-731735 is a selective FPTase inhibitor that can inhibit ras-dependent cell transformation. L-731735 can be used in cancer research[1]. |
| Name | (2S)-2-[[(2S,3S)-2-[[2-[(2-amino-3-sulfanylpropyl)amino]-3-methylpentyl]amino]-3-methylpentanoyl]amino]-4-hydroxybutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | L-731735 is a selective FPTase inhibitor that can inhibit ras-dependent cell transformation. L-731735 can be used in cancer research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.113g/cm3 |
|---|---|
| Boiling Point | 662.6ºC at 760mmHg |
| Molecular Formula | C19H40N4O4S |
| Molecular Weight | 420.61000 |
| Flash Point | 354.5ºC |
| Exact Mass | 420.27700 |
| PSA | 179.00000 |
| LogP | 2.52630 |
| Vapour Pressure | 2.24E-20mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | LMTIEVNRUFAFPM-UHFFFAOYSA-N |
| SMILES | CCC(C)C(CNC(C(=O)NC(CCO)C(=O)O)C(C)CC)NCC(N)CS |
| N-(2-(3-Mercapto-2-aminopropylamino)-3-methylpentyl)isoleucyl-homoserine |
| L-Homoserine,N-(N-(2-((2-amino-3-mercaptopropyl)amino)-3-methylpentyl)-L-isoleucyl)-,(2S-(2R*(S*),3S*)) |
| L 731,735 |
| Nampamp-ile-hse |