4-(4-Bromophenyl)-2,6-diphenylpyridine structure
|
Common Name | 4-(4-Bromophenyl)-2,6-diphenylpyridine | ||
|---|---|---|---|---|
| CAS Number | 1498-81-3 | Molecular Weight | 386.28400 | |
| Density | 1.31g/cm3 | Boiling Point | 494.2ºC at 760 mmHg | |
| Molecular Formula | C23H16BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.7ºC | |
| Name | 4-(4-Bromophenyl)-2,6-diphenylpyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 494.2ºC at 760 mmHg |
| Molecular Formula | C23H16BrN |
| Molecular Weight | 386.28400 |
| Flash Point | 252.7ºC |
| Exact Mass | 385.04700 |
| PSA | 12.89000 |
| LogP | 6.84510 |
| Vapour Pressure | 1.99E-09mmHg at 25°C |
| Index of Refraction | 1.637 |
| InChIKey | NLEJJDLDEQFMSE-UHFFFAOYSA-N |
| SMILES | Brc1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
| 4-<4-Brom-phenyl>-2,6-diphenyl-pyridin |
| 2,6-diphenyl-4-(4-bromophenyl)pyridine |
| 4-(4-bromo-phenyl)-2,6-diphenyl-pyridine |