bifenazate structure
|
Common Name | bifenazate | ||
|---|---|---|---|---|
| CAS Number | 149877-41-8 | Molecular Weight | 300.35 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H20N2O3 | Melting Point | 122℃ | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of bifenazateBifenazate is a carbazate acaricide that control 100% of mites at a concentration of 25 ppm[1]. Bifenazate is a positive allosteric modulator of GABA receptor[2]. |
| Name | bifenazate |
|---|---|
| Synonym | More Synonyms |
| Description | Bifenazate is a carbazate acaricide that control 100% of mites at a concentration of 25 ppm[1]. Bifenazate is a positive allosteric modulator of GABA receptor[2]. |
|---|---|
| Related Catalog | |
| Target |
GABA receptor[2]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Melting Point | 122℃ |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.35 |
| Exact Mass | 300.147400 |
| PSA | 59.59000 |
| LogP | 3.12 |
| Index of Refraction | 1.578 |
| InChIKey | VHLKTXFWDRXILV-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2ccccc2)cc1NNC(=O)OC(C)C |
| Storage condition | 0-6°C |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H319-H400 |
| Precautionary Statements | P273-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36-43 |
| Safety Phrases | 26-36/37 |
| RIDADR | UN 3077 9 / PGIII |
| HS Code | 2928000031 |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000031 |
|---|---|
| Summary | 2928000031 4-(2,2-dimethylhydrazinyl)-4-oxobutanoic acid。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:20.0% |
| Isopropyl-2-(4-methoxybiphenyl-3-yl)hydrazincarboxylat |
| lianbenjingzhi |
| 1-Methylethyl 2-(4-methoxybiphenyl-3-yl)hydrazinecarboxylate |
| 1Y1&OVMMR CR& FO1 |
| propan-2-yl 2-(4-methoxy[1,1’-biphenyl]-3-yl)hydrazinecarboxylate |
| 1-Methylethyl 2-(4-methoxy[1,1'-biphenyl]-3-yl)hydrazinecarboxylate |
| isopropyl 3-(4-methoxybiphenyl-3-yl)carbazate |
| 1-methylethyl 2-(4-methoxy[1,1’-biphenyl]-3-yl)hydrazinecarboxylate |
| bifenazate |
| propan-2-yl N-(2-methoxy-5-phenylanilino)carbamate |
| Isopropyl 2-(4-methoxy-3-biphenylyl)hydrazinecarboxylate |
| D 2341 |
| Isopropyl 2-(4-methoxybiphenyl-3-yl)hydrazinoformate |
| Floramite |
| Hydrazinecarboxylic acid, 2-(4-methoxy[1,1'-biphenyl]-3-yl)-, 1-methylethyl ester |