Pregnane-3,11,20-trione,21-(acetyloxy)-17-hydroxy-, (5b)- (9CI) structure
|
Common Name | Pregnane-3,11,20-trione,21-(acetyloxy)-17-hydroxy-, (5b)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 1499-59-8 | Molecular Weight | 404.49700 | |
| Density | 1.224g/cm3 | Boiling Point | 556.1ºC at 760mmHg | |
| Molecular Formula | C23H32O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.9ºC | |
Use of Pregnane-3,11,20-trione,21-(acetyloxy)-17-hydroxy-, (5b)- (9CI)5β-Dihydrocortisone acetate can be used for the synthesis of tetrahydrocortisone 3-glucuronide[1]. |
| Name | [2-[(5R,8S,9S,10S,13S,14S,17R)-17-hydroxy-10,13-dimethyl-3,11-dioxo-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| Synonym | More Synonyms |
| Description | 5β-Dihydrocortisone acetate can be used for the synthesis of tetrahydrocortisone 3-glucuronide[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.224g/cm3 |
|---|---|
| Boiling Point | 556.1ºC at 760mmHg |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.49700 |
| Flash Point | 187.9ºC |
| Exact Mass | 404.22000 |
| PSA | 97.74000 |
| LogP | 2.64050 |
| Vapour Pressure | 1.11E-14mmHg at 25°C |
| Index of Refraction | 1.54 |
| InChIKey | AZCNJEFLSOQGST-LPEMZKRWSA-N |
| SMILES | CC(=O)OCC(=O)C1(O)CCC2C3CCC4CC(=O)CCC4(C)C3C(=O)CC21C |
| Storage condition | 2-8°C |
| terahydrocortisone-21-acetate |