2-Propenoic acid,3-phenyl-, 1,1-dimethylethyl ester structure
|
Common Name | 2-Propenoic acid,3-phenyl-, 1,1-dimethylethyl ester | ||
|---|---|---|---|---|
| CAS Number | 14990-09-1 | Molecular Weight | 204.26500 | |
| Density | 1.021g/cm3 | Boiling Point | 290.8ºC at 760mmHg | |
| Molecular Formula | C13H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.7ºC | |
| Name | tert-butyl (E)-3-phenylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.021g/cm3 |
|---|---|
| Boiling Point | 290.8ºC at 760mmHg |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.26500 |
| Flash Point | 150.7ºC |
| Exact Mass | 204.11500 |
| PSA | 26.30000 |
| LogP | 3.04150 |
| Vapour Pressure | 0.002mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | AGKLVMVJXDFIGC-MDZDMXLPSA-N |
| SMILES | CC(C)(C)OC(=O)C=Cc1ccccc1 |
| HS Code | 2916399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-Propenoic acid,3-phenyl-,1,1-diMethylethyl ester |
| tert-Butyl trans-cinnamate |
| tert-butyl cinnamate |