(s)-3-phenylalanine t-butyl ester structure
|
Common Name | (s)-3-phenylalanine t-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 16874-17-2 | Molecular Weight | 221.29500 | |
| Density | N/A | Boiling Point | 336.9ºC at 760 mmHg | |
| Molecular Formula | C13H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.6ºC | |
| Name | tert-butyl (2S)-2-amino-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 336.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.29500 |
| Flash Point | 157.6ºC |
| Exact Mass | 221.14200 |
| PSA | 52.32000 |
| LogP | 2.59840 |
| InChIKey | QOISWWBTZMFUEL-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)C(N)Cc1ccccc1 |
| Storage condition | 2-8°C |
| HS Code | 2922499990 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| AmbotzHAA1586 |
| tert-butyl L-phenylalaninate |
| H-Phe-O-t-Bu |
| H-L-Phe-OtBu |
| L-phenylalanine 1,1-dimethylethyl ester |
| 2-amino-3-phenyl-propionic acid tert-butyl ester |