1H-Azepine,1-[[1,3-bis[(4-chlorophenyl)methyl]tetrahydro-2-oxido-1,3,2-diazaphosphorin-1(2H)-yl]phosphinyl]hexahydro structure
|
Common Name | 1H-Azepine,1-[[1,3-bis[(4-chlorophenyl)methyl]tetrahydro-2-oxido-1,3,2-diazaphosphorin-1(2H)-yl]phosphinyl]hexahydro | ||
|---|---|---|---|---|
| CAS Number | 14992-07-5 | Molecular Weight | 466.38400 | |
| Density | 1.3g/cm3 | Boiling Point | 602.4ºC at 760mmHg | |
| Molecular Formula | C23H30Cl2N3OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.1ºC | |
| Name | 2-(azepan-1-yl)-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 602.4ºC at 760mmHg |
| Molecular Formula | C23H30Cl2N3OP |
| Molecular Weight | 466.38400 |
| Flash Point | 318.1ºC |
| Exact Mass | 465.15000 |
| PSA | 36.60000 |
| LogP | 6.49910 |
| Vapour Pressure | 1.81E-14mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | CBOCLSXCXFSILK-UHFFFAOYSA-N |
| SMILES | O=P1(N2CCCCCC2)N(Cc2ccc(Cl)cc2)CCCN1Cc1ccc(Cl)cc1 |
|
~%
1H-Azepine,1-[[... CAS#:14992-07-5 |
| Literature: Billman,J.H.; May,R.F. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 486 - 488 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-[1,3-bis(4-chlorobenzyl)-2-oxido-1,3,2-diazaphosphinan-2-yl]azepane |