2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3-diaza-2$l^C17H18Cl3N2OP-phosphacyclohexane 2-oxide
![2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3-diaza-2$l^C17H18Cl3N2OP-phosphacyclohexane 2-oxide Structure](https://image.chemsrc.com/caspic/090/6533-30-8.png)
2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3-diaza-2$l^C17H18Cl3N2OP-phosphacyclohexane 2-oxide structure
|
Common Name | 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3-diaza-2$l^C17H18Cl3N2OP-phosphacyclohexane 2-oxide | ||
|---|---|---|---|---|
| CAS Number | 6533-30-8 | Molecular Weight | 403.67000 | |
| Density | 1.41g/cm3 | Boiling Point | 516.5ºC at 760 mmHg | |
| Molecular Formula | C17H18Cl3N2OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 516.5ºC at 760 mmHg |
| Molecular Formula | C17H18Cl3N2OP |
| Molecular Weight | 403.67000 |
| Flash Point | 266.1ºC |
| Exact Mass | 402.02200 |
| PSA | 33.36000 |
| LogP | 5.92400 |
| Index of Refraction | 1.63 |
| InChIKey | JLJPNMVKWKBOOC-UHFFFAOYSA-N |
| SMILES | O=P1(Cl)N(Cc2ccc(Cl)cc2)CCCN1Cc1ccc(Cl)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-chloro-1,3-bi... CAS#:6533-30-8 |
| Literature: Billman,J.H. et al. Journal of Medicinal Chemistry, 1966 , vol. 9, p. 772 - 774 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 2 | |
![1H-Azepine,1-[[1,3-bis[(4-chlorophenyl)methyl]tetrahydro-2-oxido-1,3,2-diazaphosphorin-1(2H)-yl]phosphinyl]hexahydro structure](https://image.chemsrc.com/caspic/101/14992-07-5.png)
CAS#:14992-07-5![1,3,2-Diazaphosphorin-2(1H)-amine,N-(2-chloroethyl)-1,3-bis[(4-chlorophenyl)methyl]tetrahydro-, 2-oxide structure](https://image.chemsrc.com/caspic/318/14745-89-2.png)
CAS#:14745-89-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-chloro-1,3-bis(4-chlorobenzyl)-1,3,2-diazaphosphinane 2-oxide |
| 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide have? |
| A: English synonyms of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide: 2-chloro-1,3-bis(4-chlorobenzyl)-1,3,2-diazaphosphinane 2-oxide, 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2. |
| Q: What is the boiling point of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide? |
| A: Boiling point of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide is 516.5ºC at 760 mmHg. |
| Q: What is the molecular formula of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide? |
| A: Molecular formula of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide is C17H18Cl3N2OP. |
| Q: What is the CAS number of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide? |
| A: CAS number of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide is 6533-30-8. |
| Q: What is the LogP of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide? |
| A: LogP of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide is 5.92400. |
| Q: What is the InChIKey of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide? |
| A: InChIKey of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide is JLJPNMVKWKBOOC-UHFFFAOYSA-N. |
| Q: What is the English name of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide? |
| A: The English name of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide is 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide. |
| Q: What is the Chinese name of 6533-30-8? |
| A: Chinese name of 6533-30-8 is 6533-30-8. |
| Q: What is the polar surface area (PSA) of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide? |
| A: Polar surface area (PSA) of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide is 33.36000. |
| Q: What is the SMILES notation of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide? |
| A: SMILES notation of 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide is O=P1(Cl)N(Cc2ccc(Cl)cc2)CCCN1Cc1ccc(Cl)cc1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |