2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3-diaza-2$l^C17H18Cl3N2OP-phosphacyclohexane 2-oxide structure
|
Common Name | 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3-diaza-2$l^C17H18Cl3N2OP-phosphacyclohexane 2-oxide | ||
|---|---|---|---|---|
| CAS Number | 6533-30-8 | Molecular Weight | 403.67000 | |
| Density | 1.41g/cm3 | Boiling Point | 516.5ºC at 760 mmHg | |
| Molecular Formula | C17H18Cl3N2OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.1ºC | |
| Name | 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2λ5-diazaphosphinane 2-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 516.5ºC at 760 mmHg |
| Molecular Formula | C17H18Cl3N2OP |
| Molecular Weight | 403.67000 |
| Flash Point | 266.1ºC |
| Exact Mass | 402.02200 |
| PSA | 33.36000 |
| LogP | 5.92400 |
| Index of Refraction | 1.63 |
| InChIKey | JLJPNMVKWKBOOC-UHFFFAOYSA-N |
| SMILES | O=P1(Cl)N(Cc2ccc(Cl)cc2)CCCN1Cc1ccc(Cl)cc1 |
|
~%
2-chloro-1,3-bi... CAS#:6533-30-8 |
| Literature: Billman,J.H. et al. Journal of Medicinal Chemistry, 1966 , vol. 9, p. 772 - 774 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 2-chloro-1,3-bis(4-chlorobenzyl)-1,3,2-diazaphosphinane 2-oxide |
| 2-chloro-1,3-bis[(4-chlorophenyl)methyl]-1,3,2 |