4-Benzo[1,3]dioxol-5-yl-4-hydroxycyclohexanone structure
|
Common Name | 4-Benzo[1,3]dioxol-5-yl-4-hydroxycyclohexanone | ||
|---|---|---|---|---|
| CAS Number | 150019-57-1 | Molecular Weight | 234.24800 | |
| Density | 1.348g/cm3 | Boiling Point | 414.2ºC at 760mmHg | |
| Molecular Formula | C13H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162ºC | |
| Name | 4-Benzo[1,3]dioxol-5-yl-4-hydroxycyclohexanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.348g/cm3 |
|---|---|
| Boiling Point | 414.2ºC at 760mmHg |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.24800 |
| Flash Point | 162ºC |
| Exact Mass | 234.08900 |
| PSA | 55.76000 |
| LogP | 1.74600 |
| Vapour Pressure | 1.33E-07mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | ISBCBGZLNXQEEF-UHFFFAOYSA-N |
| SMILES | O=C1CCC(O)(c2ccc3c(c2)OCO3)CC1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(1,3-benzodioxol-5-yl)-4-hydroxycyclohexan-1-one |