methyl 3,5-ditert-butyl-2-hydroxybenzoate structure
|
Common Name | methyl 3,5-ditert-butyl-2-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 15018-03-8 | Molecular Weight | 264.36000 | |
| Density | 1.02g/cm3 | Boiling Point | 320.5ºC at 760 mmHg | |
| Molecular Formula | C16H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 118.6ºC | |
| Name | methyl 3,5-ditert-butyl-2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 320.5ºC at 760 mmHg |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36000 |
| Flash Point | 118.6ºC |
| Exact Mass | 264.17300 |
| PSA | 46.53000 |
| LogP | 3.77380 |
| Vapour Pressure | 0.000168mmHg at 25°C |
| Index of Refraction | 1.503 |
| InChIKey | QSGONIQEKLJPGV-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| methyl 3,5-di-tert-butyl-2-hydroxybenzoate |
| Methyl-3,5-di-tert-butylsalicylat |
| Methyl 3,5-di-t-butylsalicylate |
| methyl 3,5-bis(tert-butyl)-2-hydroxybenzoate |
| 3.5-Di-t-butyl-salicylsaeure-methylester |
| Methyl 3,5-di-tert-butylsalicylate |