ethyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate structure
|
Common Name | ethyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 150190-03-7 | Molecular Weight | 181.18900 | |
| Density | 1.193g/cm3 | Boiling Point | 371.5ºC at 760mmHg | |
| Molecular Formula | C9H11NO3 | Melting Point | 188-190ºC | |
| MSDS | N/A | Flash Point | 178.5ºC | |
| Name | ethyl 2-methyl-6-oxo-1H-pyridine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 371.5ºC at 760mmHg |
| Melting Point | 188-190ºC |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.18900 |
| Flash Point | 178.5ºC |
| Exact Mass | 181.07400 |
| PSA | 59.42000 |
| LogP | 1.27230 |
| Vapour Pressure | 4.79E-06mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | WZUAZSMUJJUHMM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(C)[nH]c(=O)c1 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Pyridinecarboxylicacid,1,2-dihydro-6-methyl-2-oxo-,ethyl ester |
| ethyl 2-hydroxy-6-methylpyridine-4-carboxylate |
| 1,2-Dihydro-6-methyl-2-oxopyridin-4-carbonsaeure-ethylester |
| Ethyl 2-hydroxy-6-methylisonicotinate |
| 6-methyl-2-oxo-1,2-dihydro-pyridine-4-carboxylic acid ethyl ester |
| MFCD09953494 |