9-Oxoheptadecanedioic acid structure
|
Common Name | 9-Oxoheptadecanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 1502-36-9 | Molecular Weight | 314.41700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H30O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 9-Oxoheptadecanedioic acid9-Oxoheptadecanedioic acid (compound 46) is a precursor of Civetone used for labeling proteins[1]. |
| Name | 9-oxoheptadecanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 9-Oxoheptadecanedioic acid (compound 46) is a precursor of Civetone used for labeling proteins[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H30O5 |
|---|---|
| Molecular Weight | 314.41700 |
| Exact Mass | 314.20900 |
| PSA | 91.67000 |
| LogP | 4.18610 |
| InChIKey | PIDPYYAWBYNTFO-UHFFFAOYSA-N |
| SMILES | O=C(O)CCCCCCCC(=O)CCCCCCCC(=O)O |
| Precursor 10 | |
|---|---|
| DownStream 4 | |
| 9-oxo-heptadecanedioic acid |
| 9-Oxo-heptadecandisaeure |
| Civetondicarbonsaeure |
| Heptadecanedioic acid,9-oxo |