Benzoicacid, 4-chloro-, 4-methylphenyl ester structure
|
Common Name | Benzoicacid, 4-chloro-, 4-methylphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 15024-10-9 | Molecular Weight | 246.68900 | |
| Density | 1.226g/cm3 | Boiling Point | 356.6ºC at 760mmHg | |
| Molecular Formula | C14H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | p-Chlor-benzoesaeure-p-tolylester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 356.6ºC at 760mmHg |
| Molecular Formula | C14H11ClO2 |
| Molecular Weight | 246.68900 |
| Exact Mass | 246.04500 |
| PSA | 26.30000 |
| LogP | 3.86760 |
| Vapour Pressure | 2.89E-05mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | FNKKDQKBNWQMMW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OC(=O)c2ccc(Cl)cc2)cc1 |
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
|---|---|
| Risk Phrases | 43-50/53 |
| Safety Phrases | 24-37-60-61 |
| HS Code | 2916399090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-methylphenyl 4-chlorobenzoate |
| 4-chloro-benzoic acid,4-methylphenyl ester |
| 4-chloro-benzoic acid p-tolyl ester |
| 4-Chlor-benzoesaeure-p-tolylester |
| p-tolyl 4-chlorobenzoate |