1-(4-CHLORO-3-NITROPHENYL)PROPAN-1-ONE structure
|
Common Name | 1-(4-CHLORO-3-NITROPHENYL)PROPAN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 15026-82-1 | Molecular Weight | 267.70800 | |
| Density | 1.35g/cm3 | Boiling Point | 492.2ºC at 760mmHg | |
| Molecular Formula | C13H14ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.5ºC | |
| Name | 1-[(4-chlorobenzoyl)amino]cyclopentane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 492.2ºC at 760mmHg |
| Molecular Formula | C13H14ClNO3 |
| Molecular Weight | 267.70800 |
| Flash Point | 251.5ºC |
| Exact Mass | 267.06600 |
| PSA | 66.40000 |
| LogP | 2.85810 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | NMVQYHKJSJCHQU-UHFFFAOYSA-N |
| SMILES | O=C(NC1(C(=O)O)CCCC1)c1ccc(Cl)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-<4-Chlor-benzoylamino>-cyclopentan-1-carbonsaeure |
| GL-0549 |