1-(4-bromo-3-nitrophenyl)propan-1-one structure
|
Common Name | 1-(4-bromo-3-nitrophenyl)propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 101860-83-7 | Molecular Weight | 258.06900 | |
| Density | 1.559g/cm3 | Boiling Point | 291.2ºC at 760mmHg | |
| Molecular Formula | C9H8BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.9ºC | |
| Name | 1-(4-bromo-3-nitrophenyl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.559g/cm3 |
|---|---|
| Boiling Point | 291.2ºC at 760mmHg |
| Molecular Formula | C9H8BrNO3 |
| Molecular Weight | 258.06900 |
| Flash Point | 129.9ºC |
| Exact Mass | 256.96900 |
| PSA | 62.89000 |
| LogP | 3.47320 |
| Vapour Pressure | 0.00197mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | TZELZSUMAATQRO-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1ccc(Br)c([N+](=O)[O-])c1 |
|
~20%
1-(4-bromo-3-ni... CAS#:101860-83-7 |
| Literature: Ates-Alagoz, Zeynep; Coleman, Natalia; Martin, Marlena; Wan, Aaron; Adejare, Adeboye Chemical Biology and Drug Design, 2012 , vol. 80, # 6 p. 853 - 861 |
| 1-(4-Bromo-3-nitrophenyl)-1-propanone |
| 4'-bromo-3'-nitropropiophenone |
| 3'-Nitro-4'-bromopropiophenone |
| 4-Brom-3-nitro-propiophenon |
| 4-Bromo-3-nitro-propiophenon |