Fmoc-HoCys(ACM)-OH structure
|
Common Name | Fmoc-HoCys(ACM)-OH | ||
|---|---|---|---|---|
| CAS Number | 150281-21-3 | Molecular Weight | 428.501 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 731.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C22H24N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 396.0±32.9 °C | |
Use of Fmoc-HoCys(ACM)-OHFmoc-HoCys(ACM)-OH, a homolog of cysteine, is synthesized from L-methionine. Fmoc-HoCys(ACM)-OH also can be used for the synthesis of solid phase peptide[1]. |
| Name | Acetamido-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-methionine |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-HoCys(ACM)-OH, a homolog of cysteine, is synthesized from L-methionine. Fmoc-HoCys(ACM)-OH also can be used for the synthesis of solid phase peptide[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Fmoc-HoCys(ACM)-OH (compound 1) can be used in solid phase peptide synthesis using an Fmoc-based strategy[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 731.2±60.0 °C at 760 mmHg |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.501 |
| Flash Point | 396.0±32.9 °C |
| Exact Mass | 428.140594 |
| LogP | 3.30 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | LKXJXPIRDOELQS-FQEVSTJZSA-N |
| SMILES | CC(=O)NCSCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| Hazard Codes | Xn |
|---|
| L-Methionine, (acetylamino)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| MFCD03788052 |
| Acetamido-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-methionine |