2,4,4-trimethyl-N-(2-methylbutan-2-yl)pentan-2-amine structure
|
Common Name | 2,4,4-trimethyl-N-(2-methylbutan-2-yl)pentan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 150285-07-7 | Molecular Weight | 199.37600 | |
| Density | 0.808 g/mL at 25ºC(lit.) | Boiling Point | 200ºC(lit.) | |
| Molecular Formula | C13H29N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167 °F | |
| Name | 2,4,4-trimethyl-N-(2-methylbutan-2-yl)pentan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.808 g/mL at 25ºC(lit.) |
|---|---|
| Boiling Point | 200ºC(lit.) |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.37600 |
| Flash Point | 167 °F |
| Exact Mass | 199.23000 |
| PSA | 12.03000 |
| LogP | 4.37030 |
| Vapour Pressure | 0.0701mmHg at 25°C |
| Index of Refraction | n20/D 1.443(lit.) |
| InChIKey | RMRFHMLPQSZGLP-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)NC(C)(C)CC(C)(C)C |
| HS Code | 2921199090 |
|---|---|
| Summary | 2921199090 other acyclic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00209544 |
| tert-Amyl-tert-octylamine |
| 2-Heptanamine,N-(1,1-dimethylpropyl)-2-methyl |