N-[(Benzyloxy)carbonyl]-2-methylalanine structure
|
Common Name | N-[(Benzyloxy)carbonyl]-2-methylalanine | ||
|---|---|---|---|---|
| CAS Number | 15030-72-5 | Molecular Weight | 103.120 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 204.4±23.0 °C at 760 mmHg | |
| Molecular Formula | C4H9NO2 | Melting Point | 65-69ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 77.4±22.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of N-[(Benzyloxy)carbonyl]-2-methylalanineZ-Aib-OH is an alanine derivative[1]. |
| Name | 2-methyl-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Z-Aib-OH is an alanine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 204.4±23.0 °C at 760 mmHg |
| Melting Point | 65-69ºC(lit.) |
| Molecular Formula | C4H9NO2 |
| Molecular Weight | 103.120 |
| Flash Point | 77.4±22.6 °C |
| Exact Mass | 103.063332 |
| PSA | 75.63000 |
| LogP | -0.33 |
| Vapour Pressure | 0.1±0.8 mmHg at 25°C |
| Index of Refraction | 1.540 |
| InChIKey | QKVCSJBBYNYZNM-UHFFFAOYSA-N |
| SMILES | CC(C)(NC(=O)OCc1ccccc1)C(=O)O |
| Storage condition | -20°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
|
~99%
N-[(Benzyloxy)c... CAS#:15030-72-5 |
| Literature: Lai, Michelle Y.H.; Brimble, Margaret A.; Callis, David J.; Harris, Paul W.R.; Levi, Mark S.; Sieg, Frank Bioorganic and Medicinal Chemistry, 2005 , vol. 13, # 2 p. 533 - 548 |
|
~74%
N-[(Benzyloxy)c... CAS#:15030-72-5 |
| Literature: Sunesis Pharmaceuticals, Inc. Patent: US2009/36419 A1, 2009 ; Location in patent: Page/Page column 93 ; US 20090036419 A1 |
|
~32%
N-[(Benzyloxy)c... CAS#:15030-72-5 |
| Literature: NEUREN PHARMACEUTICALS LIMITED; NEUREN PHARMACEUTICALS INC. Patent: WO2006/127702 A2, 2006 ; Location in patent: Page/Page column 70-71 ; |
|
~%
N-[(Benzyloxy)c... CAS#:15030-72-5 |
| Literature: Journal of Biological Chemistry, , vol. 109, p. 344 |
|
~%
N-[(Benzyloxy)c... CAS#:15030-72-5 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 43, p. 3873,3881 |
|
~0%
N-[(Benzyloxy)c... CAS#:15030-72-5 |
| Literature: Valle, Giovanni; Formaggio, Fernando; Crisma, Marco; Bonora, Gian Maria; Toniolo, Claudio; et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1986 , p. 1371 - 1376 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| a-Methylalanine |
| α-Methylalanine |
| 2-benzyloxycarbonylamino-2-methyl-propionic acid |
| N-Carbobenzyloxy-2-methylalanine |
| 2-Aminoisobutyricacid |
| α-Aminoisobutyric acid |
| Alanine, 2-methyl- |
| Z-2-Methylalanine |
| N-CBZ-2-methylalanine |
| MFCD00004190 |
| 2-Ammonio-2-methylpropanoate |
| 2-(((Benzyloxy)carbonyl)amino)-2-methylpropanoic acid |
| Alanine, 2-methyl-N-[(phenylmethoxy)carbonyl]- |
| N-Cbz-2-amino-2-methylpropanoic acid |
| (α-methyl)alanine |
| a-Aminoisobutyric acid |
| a-Aminoisobutanoic acid |
| N-[(Benzyloxy)carbonyl]-2-methylalanine |
| 2-Amino-2-MethylpropionicAcid |
| 2-Aminoisobutyric Acid |
| Aib |
| N-Cbz-Aib-OH |
| Z-Aib-OH |