1-Benzyl-4-(Boc-amino)piperidine-4-carboxylic Acid structure
|
Common Name | 1-Benzyl-4-(Boc-amino)piperidine-4-carboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 150435-81-7 | Molecular Weight | 334.410 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 486.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C18H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.3±28.7 °C | |
| Name | 1-Benzyl-4-(Boc-amino)piperidine-4-carboxylic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 486.9±45.0 °C at 760 mmHg |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.410 |
| Flash Point | 248.3±28.7 °C |
| Exact Mass | 334.189270 |
| PSA | 78.87000 |
| LogP | 2.85 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | WZXFCLVBUXTWRS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(C(=O)O)CCN(Cc2ccccc2)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Benzyl-4-(Boc-amino)piperidine-4-carboxylic acid |
| 1-Benzyl-4-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-4-piperidinecarboxylic acid |
| 1-Benzyl-4-[(tert-butoxycarbonyl)amino]piperidine-4-carboxylic acid |
| 4-Piperidinecarboxylic acid, 4-[[(1,1-dimethylethoxy)carbonyl]amino]-1-(phenylmethyl)- |
| 1-benzyl-4-[(2-methylpropan-2-yl)oxycarbonylamino]piperidine-4-carboxylic acid |