(S)-3-(Allyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid structure
|
Common Name | (S)-3-(Allyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 150438-78-1 | Molecular Weight | 245.27200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H19NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (S)-3-(Allyloxy)-2-((tert-butoxycarbonyl)amino)propanoic acidN-Boc-O-allyl-L-serine is a derivative of L-serine, can be used for compounds synthesis[1]. |
| Name | (2S)-3-allyloxy-2-tert-butoxycarbonylaminopropionic acid |
|---|---|
| Synonym | More Synonyms |
| Description | N-Boc-O-allyl-L-serine is a derivative of L-serine, can be used for compounds synthesis[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Matthew Netherton, et al. Compounds and uses thereof. WO2021155321A2 (Intermediate 3) |
| Molecular Formula | C11H19NO5 |
|---|---|
| Molecular Weight | 245.27200 |
| Exact Mass | 245.12600 |
| PSA | 84.86000 |
| LogP | 1.55780 |
| InChIKey | AJBUKLQZLAOFEA-QMMMGPOBSA-N |
| SMILES | C=CCOCC(NC(=O)OC(C)(C)C)C(=O)O |
| Hazard Codes | Xn |
|---|
| Boc-L-Ser(allyl)-OH |
| N-Boc-O-allyl-Ser-OH |
| N-Boc-O-allyl-L-serine |
| (S)-3-(allyloxy)-2-(tert-butoxycarbonylamino)propanoic acid |
| Boc-O-allyl-L-serine |
| (2S)-2-{[(tert-butoxy)carbonyl]amino}-3-(prop-2-en-1-yloxy)propanoic acid |
| (S)-3-Allyloxy-2-tert-butoxycarbonylamino-propionic acid |