3-(3,5-dichloroanilino)propanoic acid structure
|
Common Name | 3-(3,5-dichloroanilino)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 150571-02-1 | Molecular Weight | 234.07900 | |
| Density | 1.459g/cm3 | Boiling Point | 442.4ºC at 760mmHg | |
| Molecular Formula | C9H9Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 221.3ºC | |
| Name | 3-(3,5-dichloroanilino)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.459g/cm3 |
|---|---|
| Boiling Point | 442.4ºC at 760mmHg |
| Molecular Formula | C9H9Cl2NO2 |
| Molecular Weight | 234.07900 |
| Flash Point | 221.3ºC |
| Exact Mass | 233.00100 |
| PSA | 49.33000 |
| LogP | 2.95300 |
| Vapour Pressure | 1.32E-08mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | JLQFNPSDKJAWCH-UHFFFAOYSA-N |
| SMILES | O=C(O)CCNc1cc(Cl)cc(Cl)c1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 3-(3,5-Dichloroanilino)propanoicacid |
| 3-(3,5-DICHLOROPHENYLAMINO)PROPIONIC ACID |
| b-Alanine,N-(3,5-dichlorophenyl) |