2-(4-|tert|-Butylphenyl)-5-(4-biphenylyl)-1,3,4-oxadiazle structure
|
Common Name | 2-(4-|tert|-Butylphenyl)-5-(4-biphenylyl)-1,3,4-oxadiazle | ||
|---|---|---|---|---|
| CAS Number | 15082-28-7 | Molecular Weight | 354.444 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 505.1±53.0 °C at 760 mmHg | |
| Molecular Formula | C24H22N2O | Melting Point | 137-139 °C | |
| MSDS | Chinese USA | Flash Point | 244.9±24.9 °C | |
| Name | 2-(4-Tert-Butylphenyl)-5-(4-Biphenyl)-1,3,4-Oxadiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 505.1±53.0 °C at 760 mmHg |
| Melting Point | 137-139 °C |
| Molecular Formula | C24H22N2O |
| Molecular Weight | 354.444 |
| Flash Point | 244.9±24.9 °C |
| Exact Mass | 354.173218 |
| PSA | 38.92000 |
| LogP | 7.49 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | XZCJVWCMJYNSQO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(-c2nnc(-c3ccc(-c4ccccc4)cc3)o2)cc1 |
| Storage condition | 2-8°C |
| Water Solubility | toluene: 0.1 g/mL, clear, colorless |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Blue-light-emitting organic electroluminescence via exciplex emission based on a fluorene derivative Li, F.; et al.
J. Phys. D Appl. Phys. 37 , 1613, (2004)
|
|
|
Selective Metal Transfer and its Application to Patterned Multicolor Organic Light-Emitting Diodes Lee, D.; et al.
Adv. Mater. 16 , 1851 - 1854, (2011)
|
| 2-(4-biphenylyl)-5-(4-tert-butylphenyl)-1,3,4-oxadiazole |
| 2-(4-Biphenylyl)-5-[4-(2-methyl-2-propanyl)phenyl]-1,3,4-oxadiazole |
| 2-(biphenyl-4-yl)-5-(4-tert-butylphenyl)-1,3,4-oxadiazole |
| 2-([1,1'-Biphenyl]-4-yl)-5-(4-(tert-butyl)phenyl)-1,3,4-oxadiazole |
| 2-(4-tert-butylphenyl)-5-(4-phenylphenyl)-1,3,4-oxadiazole |
| 2-biphenyl-4-yl-5-(4-tert-butylphenyl)-1,3,4-oxadiazole |
| 1,3,4-Oxadiazole, 2-(4-biphenylyl)-5-(p-tert-butylphenyl)- |
| 1,3,4-Oxadiazole, 2-[1,1'-biphenyl]-4-yl-5-[4-(1,1-dimethylethyl)phenyl]- |
| 2-(4-tert-Butylphenyl)-5-(4-biphenyl)-1,3,4-oxadiazole |
| EINECS 239-135-7 |
| 2-(4-tert-Butylphenyl)-5-(4-biphenylyl)-1,3,4-oxadiazle |
| 1,3,4-Oxadiazole, 2-(1,1'-biphenyl)-4-yl-5-(4-(1,1-dimethylethyl)phenyl)- |
| 2-(4-tert-Butylphenyl)-5-(4-biphenylyl)-1,3,4-oxadiazole |
| MFCD00003101 |