Nazartinib S-enantiomer structure
|
Common Name | Nazartinib S-enantiomer | ||
|---|---|---|---|---|
| CAS Number | 1508256-20-9 | Molecular Weight | 495.016 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C26H31ClN6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Nazartinib S-enantiomerNazartinib S-enantiomer (EGF816 S-enantiomer) is the less active S-enantiomer of Nazartinib. Nazartinib (EGF816) is an EGFR inhibitor. |
| Name | EGF816 S-enantiomer |
|---|---|
| Synonym | More Synonyms |
| Description | Nazartinib S-enantiomer (EGF816 S-enantiomer) is the less active S-enantiomer of Nazartinib. Nazartinib (EGF816) is an EGFR inhibitor. |
|---|---|
| Related Catalog | |
| References |
[1]. Gerald Lelais, et al. Compounds and compositions for modulating egfr activity. WO 2013184757A1. |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C26H31ClN6O2 |
| Molecular Weight | 495.016 |
| Exact Mass | 494.219696 |
| LogP | 3.23 |
| Index of Refraction | 1.643 |
| InChIKey | IOMMMLWIABWRKL-OEMHODTASA-N |
| SMILES | Cc1cc(C(=O)Nc2nc3cccc(Cl)c3n2C2CCCCN(C(=O)C=CCN(C)C)C2)ccn1 |
| N-(7-Chloro-1-{(3S)-1-[(2E)-4-(dimethylamino)-2-butenoyl]-3-azepanyl}-1H-benzimidazol-2-yl)-2-methylisonicotinamide |
| 4-Pyridinecarboxamide, N-[7-chloro-1-[(3S)-1-[(2E)-4-(dimethylamino)-1-oxo-2-buten-1-yl]hexahydro-1H-azepin-3-yl]-1H-benzimidazol-2-yl]-2-methyl- |
| EGF816 (S-enantiomer) |