Tipifarnib (S enantiomer) structure
|
Common Name | Tipifarnib (S enantiomer) | ||
|---|---|---|---|---|
| CAS Number | 192185-71-0 | Molecular Weight | 489.39600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H22Cl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tipifarnib (S enantiomer)Tipifarnib S enantiomer is the S-enantiomer of Tipifarnib. Tipifarnib is a potent and specific farnesyltransferase (FTase) inhibitor with IC50 of 0.6 nM. Tipifarnib S enantiomer is the less active isomer. |
| Name | (S)-6-[amino(4-chlorophenyl)(1-methyl-1H-imidazol-5-yl)methyl]-4-(3-chlorophenyl)-1-methyl-2(1H)-quinolinone |
|---|---|
| Synonym | More Synonyms |
| Description | Tipifarnib S enantiomer is the S-enantiomer of Tipifarnib. Tipifarnib is a potent and specific farnesyltransferase (FTase) inhibitor with IC50 of 0.6 nM. Tipifarnib S enantiomer is the less active isomer. |
|---|---|
| Related Catalog |
| Molecular Formula | C27H22Cl2N4O |
|---|---|
| Molecular Weight | 489.39600 |
| Exact Mass | 488.11700 |
| PSA | 65.84000 |
| LogP | 6.19670 |
| InChIKey | PLHJCIYEEKOWNM-MHZLTWQESA-N |
| SMILES | Cn1cncc1C(N)(c1ccc(Cl)cc1)c1ccc2c(c1)c(-c1cccc(Cl)c1)cc(=O)n2C |
| Storage condition | 2-8℃ |
| tipifarnib |
| Tipifarnib (S enantiomer) |