N-butyl ricinoleate structure
|
Common Name | N-butyl ricinoleate | ||
|---|---|---|---|---|
| CAS Number | 151-13-3 | Molecular Weight | 354.56700 | |
| Density | 0,919 g/cm3 | Boiling Point | 185°C 1mm | |
| Molecular Formula | C22H42O3 | Melting Point | -10°C | |
| MSDS | N/A | Flash Point | 115 °C | |
Use of N-butyl ricinoleateButyl Ricinoleate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Butyl Ricinoleate |
|---|---|
| Synonym | More Synonyms |
| Description | Butyl Ricinoleate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 0,919 g/cm3 |
|---|---|
| Boiling Point | 185°C 1mm |
| Melting Point | -10°C |
| Molecular Formula | C22H42O3 |
| Molecular Weight | 354.56700 |
| Flash Point | 115 °C |
| Exact Mass | 354.31300 |
| PSA | 46.53000 |
| LogP | 6.33800 |
| Vapour Pressure | 4.15E-10mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | HGWAKQDTQVDVRP-UHFFFAOYSA-N |
| SMILES | CCCCCCC(O)CC=CCCCCCCCC(=O)OCCCC |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|---|
| Safety Phrases | S22-S24/25 |
| WGK Germany | 3 |
| HS Code | 29093090 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| N-BUTYL RICINOLEATE |
| MFCD00136031 |
| Ricinolic Acid Butyl Ester |
| EINECS 205-785-5 |
| Ricinoleic Acid Butyl Ester |