methohexital
methohexital structure
|
Common Name | methohexital | ||
|---|---|---|---|---|
| CAS Number | 151-83-7 | Molecular Weight | 262.30400 | |
| Density | 1.113 | Boiling Point | N/A | |
| Molecular Formula | C14H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Symbol |
GHS06 |
Signal Word | Danger | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methohexital |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.113 |
|---|---|
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.30400 |
| Exact Mass | 262.13200 |
| PSA | 66.48000 |
| LogP | 1.57330 |
| Index of Refraction | 1.504 |
| InChIKey | NZXKDOXHBHYTKP-UHFFFAOYSA-N |
| SMILES | C=CCC1(C(C)C#CCC)C(=O)NC(=O)N(C)C1=O |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 |
| Precautionary Statements | Missing Phrase - N15.00950417 |
| Hazard Codes | F,T |
| Risk Phrases | 11-23/24/25-39/23/24/25 |
| Safety Phrases | 16-36/37-45 |
| RIDADR | UN 3249 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Methohexital |
| EINECS 205-798-6 |
| methohexitone |
| Methodrexitone |
| Methhexital |
| Brietal |
| Brevital |
| Methohexiton |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of methohexital? |
| A: InChIKey of methohexital is NZXKDOXHBHYTKP-UHFFFAOYSA-N. |
| Q: What English synonyms does methohexital have? |
| A: English synonyms of methohexital: Methohexital, EINECS 205-798-6, methohexitone, Methodrexitone, Methhexital, Brietal, Brevital, Methohexiton. |
| Q: What is the molecular formula of methohexital? |
| A: Molecular formula of methohexital is C14H18N2O3. |
| Q: What is the LogP of methohexital? |
| A: LogP of methohexital is 1.57330. |
| Q: What is the English name of methohexital? |
| A: The English name of methohexital is methohexital. |
| Q: What is the CAS number of methohexital? |
| A: CAS number of methohexital is 151-83-7. |
| Q: What is the molecular weight of methohexital? |
| A: Molecular weight of methohexital is 262.30400. |
| Q: What is the polar surface area (PSA) of methohexital? |
| A: Polar surface area (PSA) of methohexital is 66.48000. |
| Q: What is the SMILES notation of methohexital? |
| A: SMILES notation of methohexital is C=CCC1(C(C)C#CCC)C(=O)NC(=O)N(C)C1=O. |
| Q: What is the safety information for methohexital? |
| A: Safety information for methohexital: 16-36/37-45. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |