Balofloxacin Dihydrate structure
|
Common Name | Balofloxacin Dihydrate | ||
|---|---|---|---|---|
| CAS Number | 151060-21-8 | Molecular Weight | 425.45100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H28FN3O6 | Melting Point | 135 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of Balofloxacin DihydrateBalofloxacin dehydrate is a quinolone antibiotic, inhibiting the synthesis of bacterial DNA by interference with the enqyme DNA gyrase[1]. |
| Name | 1-cyclopropyl-6-fluoro-8-methoxy-7-[3-(methylamino)piperidin-1-yl]-4-oxoquinoline-3-carboxylic acid,dihydrate |
|---|---|
| Synonym | More Synonyms |
| Description | Balofloxacin dehydrate is a quinolone antibiotic, inhibiting the synthesis of bacterial DNA by interference with the enqyme DNA gyrase[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Alksne L. Balofloxacin Choongwae. Curr Opin Investig Drugs. 2003 Feb;4(2):224-9. |
| Melting Point | 135 °C |
|---|---|
| Molecular Formula | C20H28FN3O6 |
| Molecular Weight | 425.45100 |
| Exact Mass | 425.19600 |
| PSA | 102.26000 |
| LogP | 2.69780 |
| InChIKey | WEGNYJXOCPJAPS-UHFFFAOYSA-N |
| SMILES | CNC1CCCN(c2c(F)cc3c(=O)c(C(=O)O)cn(C4CC4)c3c2OC)C1.O.O |
| Balofloxacin dihydrate |
| UNII-SH1AVB6TVK |
| Balofloxacin hydrate |
| Baloxin |
| Neuroquinoron |