acetyl 4-[6-(4-acetyloxycarbonylphenoxy)hexoxy]benzoate structure
|
Common Name | acetyl 4-[6-(4-acetyloxycarbonylphenoxy)hexoxy]benzoate | ||
|---|---|---|---|---|
| CAS Number | 151078-50-1 | Molecular Weight | 442.45800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H26O8 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | acetyl 4-[6-(4-acetyloxycarbonylphenoxy)hexoxy]benzoate |
|---|
| Molecular Formula | C24H26O8 |
|---|---|
| Molecular Weight | 442.45800 |
| Exact Mass | 442.16300 |
| PSA | 105.20000 |
| LogP | 4.11140 |
| InChIKey | UPRXYEYFWUUHHL-UHFFFAOYSA-N |
| SMILES | CC(=O)OC(=O)c1ccc(OCCCCCCOc2ccc(C(=O)OC(C)=O)cc2)cc1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H410 |
| Precautionary Statements | P261-P273-P305 + P351 + P338-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | UN 3077 9/PG 3 |
|
~%
acetyl 4-[6-(4-... CAS#:151078-50-1 |
| Literature: THE JOHNS HOPKINS UNIVERSITY; HANES, Justin, Scot; CAMPOCHIARO, Peter, Anthony; FU, Jie Patent: WO2013/138343 A1, 2013 ; Location in patent: Page/Page column 73 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Design of an injectable system based on bioerodible polyanhydride microspheres for sustained drug delivery.
Biomaterials 23 , 4405, (2002) The fabrication, morphological characterization, and drug release kinetics from microspheres of three bioerodible polyanhydrides, poly[1,6-bis(p-carboxyphenoxy)hexane] (poly(CPH)), poly(sebacic anhydr... |