(S)-2-((tert-Butoxycarbonyl)amino)-2-methylbutanoic acid structure
|
Common Name | (S)-2-((tert-Butoxycarbonyl)amino)-2-methylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 151171-11-8 | Molecular Weight | 217.26200 | |
| Density | 1.083g/cm3 | Boiling Point | 341.845ºC at 760 mmHg | |
| Molecular Formula | C10H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.542ºC | |
| Name | (S)-N-BOC-alpha-Ethylalanine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.083g/cm3 |
|---|---|
| Boiling Point | 341.845ºC at 760 mmHg |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26200 |
| Flash Point | 160.542ºC |
| Exact Mass | 217.13100 |
| PSA | 75.63000 |
| LogP | 2.15530 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.463 |
| InChIKey | SHZXLTCEPXVCSV-JTQLQIEISA-N |
| SMILES | CCC(C)(NC(=O)OC(C)(C)C)C(=O)O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|
|
~%
(S)-2-((tert-Bu... CAS#:151171-11-8 |
| Literature: Avenoza, Alberto; Cativiela, Carlos; Corzana, Francisco; Peregrina, Jesus M.; Zurbano, Maria M. Journal of Organic Chemistry, 1999 , vol. 64, # 22 p. 8220 - 8225 |
|
~71%
(S)-2-((tert-Bu... CAS#:151171-11-8 |
| Literature: Izdebski, Jan; Kunce, Danuta; Leplawy, Miroslaw T.; Pachulska, Maria; Redlinski, Adam Polish Journal of Chemistry, 1991 , vol. 65, # 7-8 p. 1427 - 1431 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (S)-N-BOC-α-Ethylalanine, 98% ee, 98% |
| (S)-2-((tert-Butoxycarbonyl)amino)-2-methylbutanoic acid |