2,3-dihydroxy-2-phenylpropiophenone structure
|
Common Name | 2,3-dihydroxy-2-phenylpropiophenone | ||
|---|---|---|---|---|
| CAS Number | 15121-78-5 | Molecular Weight | 242.27000 | |
| Density | 1.248g/cm3 | Boiling Point | 460.5ºC at 760mmHg | |
| Molecular Formula | C15H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.4ºC | |
| Name | 2,3-dihydroxy-1,2-diphenylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 460.5ºC at 760mmHg |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27000 |
| Flash Point | 246.4ºC |
| Exact Mass | 242.09400 |
| PSA | 57.53000 |
| LogP | 1.74940 |
| Vapour Pressure | 2.81E-09mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | AOGNACZDZNOTSN-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(O)(CO)c1ccccc1 |
| HS Code | 2914400090 |
|---|
|
~96%
2,3-dihydroxy-2... CAS#:15121-78-5 |
| Literature: Clerici, Angelo; Porta, Ombretta Journal of Organic Chemistry, 1989 , vol. 54, # 16 p. 3872 - 3878 |
|
~0%
2,3-dihydroxy-2... CAS#:15121-78-5 |
| Literature: Harris, Alan R.; Mason, Timothy J. Synthetic Communications, 1989 , vol. 19, # 3and4 p. 529 - 536 |
|
~%
2,3-dihydroxy-2... CAS#:15121-78-5 |
| Literature: Kusin Chemische Berichte, 1935 , vol. 68, p. 2169,2172 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,3-dihydroxy-1,2-diphenyl-propan-1-one |
| 2,3-dihydroxy-1,2-diphenyl-1-propanone |
| 2,3-Dihydroxy-1,2-diphenyl-propan-1-on |
| EINECS 239-177-6 |
| 2,3-Dihydroxy-2-phenylpropiophenone |