4-nitrobenzenediazonium,hexafluorophosphate structure
|
Common Name | 4-nitrobenzenediazonium,hexafluorophosphate | ||
|---|---|---|---|---|
| CAS Number | 1514-52-9 | Molecular Weight | 295.07900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4F6N3O2P | Melting Point | 140ºC (dec.)(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-nitrobenzenediazonium,hexafluorophosphate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 140ºC (dec.)(lit.) |
|---|---|
| Molecular Formula | C6H4F6N3O2P |
| Molecular Weight | 295.07900 |
| Exact Mass | 294.99500 |
| PSA | 87.56000 |
| LogP | 5.98498 |
| InChIKey | PXRFUEAIZAOVBL-UHFFFAOYSA-N |
| SMILES | F[P-](F)(F)(F)(F)F.N#[N+]c1ccc([N+](=O)[O-])cc1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| Packaging Group | III |
|
~78%
4-nitrobenzened... CAS#:1514-52-9 |
| Literature: Kosynkin, Dmitry; Bockman, T. Michael; Kochi, Jay K. Journal of the Chemical Society. Perkin Transactions 2, 1997 , # 10 p. 2003 - 2012 |
| {p-NO2C6H4N2}{PF6} |
| p-Nitrophenyldiazonium hexafluorophosphate |
| 4-Nitrobenzenediazonium hexafluorophosphate |
| MFCD00012006 |
| EINECS 216-153-3 |