cis-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)stilbene structure
|
Common Name | cis-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)stilbene | ||
|---|---|---|---|---|
| CAS Number | 151416-94-3 | Molecular Weight | 432.16800 | |
| Density | 1.07g/cm3 | Boiling Point | 443.3ºC at 760mmHg | |
| Molecular Formula | C26H34B2O4 | Melting Point | 69-73ºC(lit.) | |
| MSDS | N/A | Flash Point | 221.9ºC | |
| Name | cis-1,2-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)stilbene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07g/cm3 |
|---|---|
| Boiling Point | 443.3ºC at 760mmHg |
| Melting Point | 69-73ºC(lit.) |
| Molecular Formula | C26H34B2O4 |
| Molecular Weight | 432.16800 |
| Flash Point | 221.9ºC |
| Exact Mass | 432.26400 |
| PSA | 36.92000 |
| LogP | 5.86020 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | YFLBNMYBKXYNJN-DQRAZIAOSA-N |
| SMILES | CC1(C)OB(C(=C(B2OC(C)(C)C(C)(C)O2)c2ccccc2)c2ccccc2)OC1(C)C |
| Safety Phrases | 24/25 |
|---|---|
| WGK Germany | 3 |
|
~99%
cis-1,2-bis(4,4... CAS#:151416-94-3 |
| Literature: Chen, Qiang; Zhao, Jian; Ishikawa, Yoshifumi; Asao, Naoki; Yamamoto, Yoshinori; Jin, Tienan Organic Letters, 2013 , vol. 15, # 22 p. 5766 - 5769 |
|
~%
cis-1,2-bis(4,4... CAS#:151416-94-3 |
| Literature: Commonwealth Scientific and Industrial Research Organisation Patent: US6713566 B1, 2004 ; |
| MFCD02683500 |