(2-methylpropan-2-yl)oxy-diphenylphosphane structure
|
Common Name | (2-methylpropan-2-yl)oxy-diphenylphosphane | ||
|---|---|---|---|---|
| CAS Number | 151484-28-5 | Molecular Weight | 258.29500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-methylpropan-2-yl)oxy-diphenylphosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H19OP |
|---|---|
| Molecular Weight | 258.29500 |
| Exact Mass | 258.11700 |
| PSA | 22.82000 |
| LogP | 3.84940 |
| InChIKey | QGIMXDDOCRLZOH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OP(c1ccccc1)c1ccccc1 |
|
~44%
(2-methylpropan... CAS#:151484-28-5 |
| Literature: Williams, D. Bradley G.; Netshiozwi, Takelani E. Tetrahedron, 2009 , vol. 65, # 48 p. 9973 - 9982 |
|
~%
(2-methylpropan... CAS#:151484-28-5 |
| Literature: Shintou, Taichi; Kikuchi, Wataru; Mukaiyama, Teruaki Bulletin of the Chemical Society of Japan, 2003 , vol. 76, # 8 p. 1645 - 1667 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| 1,1-dimethylethyl diphenylphosphinite |
| Phosphinous acid,diphenyl-,1,1-dimethylethyl ester |
| tert-butyl diphenylphosphinite |