ethyl indole-3-acrylate structure
|
Common Name | ethyl indole-3-acrylate | ||
|---|---|---|---|---|
| CAS Number | 15181-86-9 | Molecular Weight | 215.24800 | |
| Density | 1.2g/cm3 | Boiling Point | 396.4ºC at 760mmHg | |
| Molecular Formula | C13H13NO2 | Melting Point | 120-121ºC | |
| MSDS | N/A | Flash Point | 193.6ºC | |
| Name | ethyl indole-3-acrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 396.4ºC at 760mmHg |
| Melting Point | 120-121ºC |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.24800 |
| Flash Point | 193.6ºC |
| Exact Mass | 215.09500 |
| PSA | 42.09000 |
| LogP | 2.74420 |
| Vapour Pressure | 1.71E-06mmHg at 25°C |
| Index of Refraction | 1.65 |
| InChIKey | OQJSITNIWIYWPU-BQYQJAHWSA-N |
| SMILES | CCOC(=O)C=Cc1c[nH]c2ccccc12 |
| Safety Phrases | S22-S24/25 |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-indol-3-yl-acrylic acid ethyl ester |
| 3-(Indol-3-yl)-acrylsaeure-ethylester |
| Ethyl indole-3-acrylate |
| 2-Propenoic acid,3-(1H-indol-3-yl)-,ethyl ester |
| MFCD00051947 |
| Ethyl (2E)-3-(1H-indol-3-yl)-2-propenoate |
| 3-<Indolyl-(3)>-acrylsaeureethylester |
| 1H-Indole-3-acrylic acid ethyl ester |
| Indole-3-acrylic acid ethyl ester |
| 3-(1H-Indol-3-yl)propenoic acid ethyl ester |