[(2S)-1-(4-nitrophenyl)pyrrolidin-2-yl]methyl prop-2-enoate structure
|
Common Name | [(2S)-1-(4-nitrophenyl)pyrrolidin-2-yl]methyl prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 152100-45-3 | Molecular Weight | 276.28800 | |
| Density | 1.228g/cm3 | Boiling Point | 435.6ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O4 | Melting Point | 38-48ºC(lit.) | |
| MSDS | USA | Flash Point | >230 °F | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | [(2S)-1-(4-nitrophenyl)pyrrolidin-2-yl]methyl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.228g/cm3 |
|---|---|
| Boiling Point | 435.6ºC at 760 mmHg |
| Melting Point | 38-48ºC(lit.) |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.28800 |
| Flash Point | >230 °F |
| Exact Mass | 276.11100 |
| PSA | 75.36000 |
| LogP | 2.88100 |
| Vapour Pressure | 8.65E-08mmHg at 25°C |
| Index of Refraction | 1.563 |
| InChIKey | HCVPUFHAWIINEQ-ZDUSSCGKSA-N |
| SMILES | C=CC(=O)OCC1CCCN1c1ccc([N+](=O)[O-])cc1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335-H411 |
| Precautionary Statements | P261-P273-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant;N: Dangerous for the environment; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | UN 3077 9/PG 3 |
| MFCD03427203 |
| [(S)-(-)-1-(4-Nitrophenyl)-2-pyrrolidinemethyl]acrylate |
| NPP acrylate |