2-Amino-1-(4-(dimethylamino)phenyl)ethanone hydrochloride structure
|
Common Name | 2-Amino-1-(4-(dimethylamino)phenyl)ethanone hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 152278-03-0 | Molecular Weight | 214.69200 | |
| Density | N/A | Boiling Point | 368.8ºC at 760 mmHg | |
| Molecular Formula | C10H15ClN2O | Melting Point | 140-144ºC | |
| MSDS | N/A | Flash Point | 176.9ºC | |
| Name | 2-Amino-1-(4-(dimethylamino)phenyl)ethanone hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 368.8ºC at 760 mmHg |
|---|---|
| Melting Point | 140-144ºC |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.69200 |
| Flash Point | 176.9ºC |
| Exact Mass | 214.08700 |
| PSA | 46.33000 |
| LogP | 2.39630 |
| Vapour Pressure | 8.51E-06mmHg at 25°C |
| InChIKey | HFOJBHJZWUEQNE-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=O)CN)cc1.Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922399090 |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-amino-1-[4-(dimethylamino)phenyl]ethanone,hydrochloride |