Phenol, 4-bromo-,1-benzoate structure
|
Common Name | Phenol, 4-bromo-,1-benzoate | ||
|---|---|---|---|---|
| CAS Number | 1523-17-7 | Molecular Weight | 277.11300 | |
| Density | 1.465g/cm3 | Boiling Point | 359.4ºC at 760mmHg | |
| Molecular Formula | C13H9BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.1ºC | |
| Name | (4-bromophenyl) benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.465g/cm3 |
|---|---|
| Boiling Point | 359.4ºC at 760mmHg |
| Molecular Formula | C13H9BrO2 |
| Molecular Weight | 277.11300 |
| Flash Point | 171.1ºC |
| Exact Mass | 275.97900 |
| PSA | 26.30000 |
| LogP | 3.66830 |
| Vapour Pressure | 2.39E-05mmHg at 25°C |
| Index of Refraction | 1.61 |
| InChIKey | OHWWOZGHMUITKG-UHFFFAOYSA-N |
| SMILES | O=C(Oc1ccc(Br)cc1)c1ccccc1 |
| HS Code | 2916310090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2916310090 |
|---|---|
| Summary | 2916310090 other benzoic acid and its salts and esters。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 1-Benzoyloxy-4-bromobenzene |
| Phenol,p-bromo-,benzoate |
| benzoic acid 4-bromo-phenyl ester |
| p-bromophenyl benzoate |
| Phenol,4-bromo-,1-benzoate |